Attributes
UniProt ID
Protein Name
Deoxyribodipyrimidine photo-lyase
Ligand Name
DIHYDROFLAVINE-ADENINE DINUCLEOTIDE
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
YPZRHBJKEMOYQH-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=C(N2)C(=O)NC(=O)N3)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8OET
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8oetA1e8oetA2e8oetB1e8oetB2
ECOD domains from experimental PDB structures interacting with ligand FDA
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8PYK9 | n/a | FDA | 8oet | e8oetA1 | A:220-468 |
| Q8PYK9 | n/a | FDA | 8oet | e8oetB1 | B:237-465 |
| Q8PYK9 | n/a | FDA | 8oy3 | e8oy3A2 | A:220-466 |
| Q8PYK9 | n/a | FDA | 8oy3 | e8oy3B2 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oy4 | e8oy4A2 | A:220-465 |
| Q8PYK9 | n/a | FDA | 8oy4 | e8oy4B2 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oy5 | e8oy5A2 | A:220-465 |
| Q8PYK9 | n/a | FDA | 8oy5 | e8oy5B2 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oy6 | e8oy6A2 | A:220-469 |
| Q8PYK9 | n/a | FDA | 8oy6 | e8oy6B1 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oy7 | e8oy7A2 | A:229-469 |
| Q8PYK9 | n/a | FDA | 8oy7 | e8oy7B1 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oy8 | e8oy8A1 | A:220-469 |
| Q8PYK9 | n/a | FDA | 8oy8 | e8oy8B2 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oy9 | e8oy9A1 | A:220-469 |
| Q8PYK9 | n/a | FDA | 8oy9 | e8oy9B2 | B:237-461 |
| Q8PYK9 | n/a | FDA | 8oya | e8oyaA2 | A:220-468 |
| Q8PYK9 | n/a | FDA | 8oya | e8oyaB1 | B:237-462 |
| Q8PYK9 | n/a | FDA | 8oyb | e8oybA2 | A:220-469 |
| Q8PYK9 | n/a | FDA | 8oyb | e8oybB1 | B:237-463 |
| Q8PYK9 | n/a | FDA | 8oyc | e8oycA2 | A:220-469 |
| Q8PYK9 | n/a | FDA | 8oyc | e8oycB2 | B:237-464 |