Attributes
UniProt ID
Protein Name
Tryptophan synthase beta chain 1
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1V8Z
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1v8zA1e1v8zA2e1v8zB1e1v8zB2e1v8zC1e1v8zC2e1v8zD1e1v8zD2
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zA1 | A:196-386 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zA2 | A:1-195 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zB1 | B:196-387 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zB2 | B:1-195 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zC1 | C:196-387 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zC2 | C:1-195 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zD1 | D:1-195 |
| Q8U093 | DB00114 | PLP | 1v8z | e1v8zD2 | D:196-382,D:384-386 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwB1 | B:1-195 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwB2 | B:196-385 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwD1 | D:1-195 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwD2 | D:196-385 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwF1 | F:196-385 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwF2 | F:1-195 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwH1 | H:196-385 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwH2 | H:1-195 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwJ1 | J:1-195 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwJ2 | J:196-385 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwL1 | L:1-195 |
| Q8U093 | DB00114 | PLP | 1wdw | e1wdwL2 | L:196-385 |