Attributes
UniProt ID
Protein Name
Tryptophan synthase beta chain 1
Ligand Name
TRYPTOPHAN
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QIVBCDIJIAJPQS-VIFPVBQESA-N
SMILES
c1ccc2c(c1)c(c[nH]2)CC(C(=O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5DW3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5dw3A1e5dw3A2e5dw3B1e5dw3B2e5dw3C1e5dw3C2e5dw3D1e5dw3D2
ECOD domains from experimental PDB structures interacting with ligand DB00150
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3A1 | A:196-384 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3A2 | A:1-195 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3B1 | B:1-195 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3B2 | B:196-387 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3C1 | C:196-385 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3C2 | C:1-195 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3D1 | D:1-195 |
| Q8U093 | DB00150 | TRP | 5dw3 | e5dw3D2 | D:196-385 |
| Q8U093 | DB00150 | TRP | 6am8 | e6am8A1 | A:196-384 |
| Q8U093 | DB00150 | TRP | 6am8 | e6am8A2 | A:1-195 |
| Q8U093 | DB00150 | TRP | 6am8 | e6am8B1 | B:1-195 |
| Q8U093 | DB00150 | TRP | 6am8 | e6am8B2 | B:196-385 |
| Q8U093 | DB00150 | TRP | 6am8 | e6am8D1 | D:196-384 |
| Q8U093 | DB00150 | TRP | 6am8 | e6am8D2 | D:1-195 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiA1 | A:1-195 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiA2 | A:196-385 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiB1 | B:1-195 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiB2 | B:196-388 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiC1 | C:196-386 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiC2 | C:1-195 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiD1 | D:196-385 |
| Q8U093 | DB00150 | TRP | 6ami | e6amiD2 | D:1-195 |
| Q8U093 | DB00150 | TRP | 7rof | e7rofA1 | A:1-195 |
| Q8U093 | DB00150 | TRP | 7rof | e7rofA2 | A:196-385 |
| Q8U093 | DB00150 | TRP | 7rof | e7rofD1 | D:1-195 |
| Q8U093 | DB00150 | TRP | 7rof | e7rofD2 | D:196-385 |