Attributes
UniProt ID
Protein Name
D-cysteine desulfhydrase
Ligand Name
4'-DEOXY-4'-AMINOPYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZMJGSOSNSPKHNH-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)CN)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4D9B
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4d9bA1e4d9bA2e4d9bB1e4d9bB2e4d9bC1e4d9bC2e4d9bD1e4d9bD2
ECOD domains from experimental PDB structures interacting with ligand DB02142
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bA1 | A:1-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bA2 | A:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bB1 | B:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bB2 | B:1-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bC1 | C:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bC2 | C:7-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bD1 | D:1-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9b | e4d9bD2 | D:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cA1 | A:1-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cA2 | A:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cB1 | B:6-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cB2 | B:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cC1 | C:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cC2 | C:8-166 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cD1 | D:167-328 |
| Q8ZNT7 | DB02142 | PMP | 4d9c | e4d9cD2 | D:1-166 |