Attributes
UniProt ID
Protein Name
L-cysteine S-thiosulfotransferase subunit SoxA
Ligand Name
HEME C
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HXQIYSLZKNYNMH-LJNAALQVSA-N
SMILES
CC=C1C(=C2C=C3C(=CC)C(=C4N3[Fe]56N2C1=Cc7n5c(c(c7C)CCC(=O)O)C=C8N6C(=C4)C(=C8CCC(=O)O)C)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1H31
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1h31A1e1h31A2e1h31B1e1h31C1e1h31C2e1h31D1e1h31E1e1h31E2e1h31F1e1h31G1e1h31G2e1h31H1
ECOD domains from experimental PDB structures interacting with ligand DB03317
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q939U1 | DB03317 | HEC | 1h31 | e1h31A1 | A:1-150 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31A2 | A:151-261 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31C1 | C:1-150 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31C2 | C:151-261 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31E1 | E:1-150 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31E2 | E:151-261 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31G1 | G:1-150 |
| Q939U1 | DB03317 | HEC | 1h31 | e1h31G2 | G:151-261 |
| Q939U1 | DB03317 | HEC | 1h32 | e1h32A1 | A:1-150 |
| Q939U1 | DB03317 | HEC | 1h32 | e1h32A2 | A:151-261 |
| Q939U1 | DB03317 | HEC | 1h33 | e1h33A1 | A:1-150 |
| Q939U1 | DB03317 | HEC | 1h33 | e1h33A2 | A:151-261 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1A1 | A:1-150 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1A2 | A:151-261 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1C1 | C:1-150 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1C2 | C:151-261 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1E1 | E:1-150 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1E2 | E:151-261 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1G1 | G:1-150 |
| Q939U1 | DB03317 | HEC | 2oz1 | e2oz1G2 | G:151-261 |