Attributes
UniProt ID
Protein Name
Benzoate-coenzyme A ligase
Ligand Name
ADENOSINE MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UDMBCSSLTHHNCD-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6M2T
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6m2tA1e6m2tA2e6m2tA3e6m2tA4e6m2tB1e6m2tB2e6m2tB3e6m2tB4e6m2tC1e6m2tC2e6m2tC3e6m2tC4e6m2tD1e6m2tD2e6m2tD3e6m2tD4
ECOD domains from experimental PDB structures interacting with ligand DB00131
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tA2 | A:160-339 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tA3 | A:340-411 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tA4 | A:412-523 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tB2 | B:160-339 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tB3 | B:412-523 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tB4 | B:340-411 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tC1 | C:160-339 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tC2 | C:412-523 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tC3 | C:340-411 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tD1 | D:160-339 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tD2 | D:412-523 |
| Q93TK0 | DB00131 | AMP | 6m2t | e6m2tD4 | D:340-411 |
| Q93TK0 | DB00131 | AMP | 6m2u | e6m2uA2 | A:340-411 |
| Q93TK0 | DB00131 | AMP | 6m2u | e6m2uA3 | A:412-523 |
| Q93TK0 | DB00131 | AMP | 6m2u | e6m2uA4 | A:160-339 |
| Q93TK0 | DB00131 | AMP | 6m2u | e6m2uB1 | B:412-523 |
| Q93TK0 | DB00131 | AMP | 6m2u | e6m2uB2 | B:340-411 |
| Q93TK0 | DB00131 | AMP | 6m2u | e6m2uB3 | B:160-339 |