Attributes
UniProt ID
Protein Name
Somatic embryogenesis receptor kinase 1
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4LSC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4lscA1
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q94AG2 | DB00141 | NAG | 4lsc | e4lscA1 | A:27-212 |
| Q94AG2 | DB00141 | NAG | 4lsx | e4lsxC1 | C:27-211 |
| Q94AG2 | DB00141 | NAG | 4lsx | e4lsxD1 | D:27-211 |
| Q94AG2 | DB00141 | NAG | 4z64 | e4z64C1 | C:26-211 |
| Q94AG2 | DB00141 | NAG | 5iyx | e5iyxC1 | C:26-211 |
| Q94AG2 | DB00141 | NAG | 7odv | e7odvBBB1 | BBB:27-211 |
| Q94AG2 | DB00141 | NAG | 7odv | e7odvEEE1 | EEE:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogo | e7ogoBBB1 | BBB:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogo | e7ogoEEE1 | EEE:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogq | e7ogqBBB1 | BBB:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogu | e7oguBBB1 | BBB:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogu | e7oguEEE1 | EEE:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogu | e7oguHHH1 | HHH:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogu | e7oguKKK1 | KKK:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogz | e7ogzBBB1 | BBB:27-211 |
| Q94AG2 | DB00141 | NAG | 7ogz | e7ogzEEE1 | EEE:27-211 |