Attributes
UniProt ID
Protein Name
NTPase P4
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1W44
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1w44A1e1w44B1e1w44C1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q94M05 | DB16833 | ADP | 1w44 | e1w44A1 | A:1-321 |
| Q94M05 | DB16833 | ADP | 1w44 | e1w44B1 | B:1-321 |
| Q94M05 | DB16833 | ADP | 1w44 | e1w44C1 | C:1-321 |
| Q94M05 | DB16833 | ADP | 1w46 | e1w46A1 | A:1-299 |
| Q94M05 | DB16833 | ADP | 1w46 | e1w46B1 | B:1-299 |
| Q94M05 | DB16833 | ADP | 1w46 | e1w46C1 | C:1-299 |
| Q94M05 | DB16833 | ADP | 1w47 | e1w47A1 | A:1-299 |
| Q94M05 | DB16833 | ADP | 1w47 | e1w47B1 | B:1-299 |
| Q94M05 | DB16833 | ADP | 1w47 | e1w47C1 | C:1-299 |
| Q94M05 | DB16833 | ADP | 1w4b | e1w4bA1 | A:1-299 |
| Q94M05 | DB16833 | ADP | 1w4b | e1w4bB1 | B:1-299 |
| Q94M05 | DB16833 | ADP | 1w4b | e1w4bC1 | C:1-299 |
| Q94M05 | DB16833 | ADP | 2vhj | e2vhjA1 | A:1-300 |
| Q94M05 | DB16833 | ADP | 2vhj | e2vhjB1 | B:1-300 |
| Q94M05 | DB16833 | ADP | 2vhj | e2vhjC1 | C:1-300 |
| Q94M05 | DB16833 | ADP | 2vhu | e2vhuA1 | A:1-300 |
| Q94M05 | DB16833 | ADP | 2vhu | e2vhuB1 | B:1-300 |
| Q94M05 | DB16833 | ADP | 2vhu | e2vhuC1 | C:1-300 |