Attributes
UniProt ID
Protein Name
Cryptochrome-2
Ligand Name
FLAVIN-ADENINE DINUCLEOTIDE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VWWQXMAJTJZDQX-UYBVJOGSSA-N
SMILES
Cc1cc2c(cc1C)N(C3=NC(=O)NC(=O)C3=N2)CC(C(C(COP(=O)(O)OP(=O)(O)OCC4C(C(C(O4)n5cnc6c5ncnc6N)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6K8I
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6k8iA1e6k8iA2e6k8iB1e6k8iB2
ECOD domains from experimental PDB structures interacting with ligand DB03147
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q96524 | DB03147 | FAD | 6k8i | e6k8iA2 | A:195-484 |
| Q96524 | DB03147 | FAD | 6k8i | e6k8iB2 | B:195-488 |
| Q96524 | DB03147 | FAD | 6k8k | e6k8kA1 | A:195-495 |
| Q96524 | DB03147 | FAD | 6k8k | e6k8kB2 | B:195-494 |
| Q96524 | DB03147 | FAD | 6k8k | e6k8kD1 | D:195-495 |
| Q96524 | DB03147 | FAD | 6k8k | e6k8kG2 | G:195-495 |
| Q96524 | DB03147 | FAD | 6m79 | e6m79A1 | A:195-484 |
| Q96524 | DB03147 | FAD | 6m79 | e6m79B2 | B:195-488 |
| Q96524 | DB03147 | FAD | 6m79 | e6m79C2 | C:195-484 |
| Q96524 | DB03147 | FAD | 6m79 | e6m79D1 | D:195-488 |
| Q96524 | DB03147 | FAD | 6x24 | e6x24A1 | A:195-485 |
| Q96524 | DB03147 | FAD | 6x24 | e6x24B2 | B:195-485 |
| Q96524 | DB03147 | FAD | 6x24 | e6x24C1 | C:195-486 |
| Q96524 | DB03147 | FAD | 6x24 | e6x24D1 | D:195-486 |
| Q96524 | DB03147 | FAD | 7x0x | e7x0xA1 | A:195-494 |
| Q96524 | DB03147 | FAD | 7x0x | e7x0xB2 | B:195-494 |
| Q96524 | DB03147 | FAD | 7x0x | e7x0xC2 | C:195-494 |
| Q96524 | DB03147 | FAD | 7x0x | e7x0xD2 | D:195-494 |
| Q96524 | DB03147 | FAD | 7x0y | e7x0yA2 | A:195-476 |
| Q96524 | DB03147 | FAD | 7x0y | e7x0yB2 | B:195-477 |
| Q96524 | DB03147 | FAD | 7x0y | e7x0yC1 | C:195-475 |
| Q96524 | DB03147 | FAD | 7x0y | e7x0yD2 | D:195-477 |