Attributes
UniProt ID
Protein Name
Interleukin-17 receptor A
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3JVF
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3jvfA1e3jvfB1e3jvfC1e3jvfC2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q96F46 | DB00141 | NAG | 3jvf | e3jvfC1 | C:2-167 |
| Q96F46 | DB00141 | NAG | 4hsa | e4hsaC1 | C:2-167 |
| Q96F46 | DB00141 | NAG | 4hsa | e4hsaC2 | C:168-273 |
| Q96F46 | DB00141 | NAG | 4hsa | e4hsaF1 | F:168-272 |
| Q96F46 | DB00141 | NAG | 4hsa | e4hsaF2 | F:2-167 |
| Q96F46 | DB00141 | NAG | 5n9b | e5n9bA2 | A:199-305 |
| Q96F46 | DB00141 | NAG | 5nan | e5nanB1 | B:33-198 |
| Q96F46 | DB00141 | NAG | 5nan | e5nanB2 | B:199-303 |
| Q96F46 | DB00141 | NAG | 5nan | e5nanC2 | C:199-303 |
| Q96F46 | DB00141 | NAG | 7uwl | e7uwlE1 | E:33-198 |
| Q96F46 | DB00141 | NAG | 7uwl | e7uwlF2 | F:199-303 |
| Q96F46 | DB00141 | NAG | 7uwm | e7uwmC2 | C:199-304 |
| Q96F46 | DB00141 | NAG | 7uwm | e7uwmF2 | F:33-198 |
| Q96F46 | DB00141 | NAG | 7uwn | e7uwnC2 | C:199-304 |
| Q96F46 | DB00141 | NAG | 7uwn | e7uwnF1 | F:33-198 |
| Q96F46 | DB00141 | NAG | 7zan | e7zanC2 | C:33-198 |