Attributes
UniProt ID
Protein Name
NACHT, LRR and PYD domains-containing protein 3
Ligand Name
PHOSPHOTHIOPHOSPHORIC ACID-ADENYLATE ESTER
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NLTUCYMLOPLUHL-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 8EJ4
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse8ej4A1e8ej4A2e8ej4A3e8ej4A4e8ej4A5e8ej4B1e8ej4B2e8ej4B3e8ej4B4e8ej4B5e8ej4C1e8ej4C2e8ej4C3e8ej4C4e8ej4C5e8ej4D1e8ej4D2e8ej4D3e8ej4D4e8ej4D5e8ej4E1e8ej4E2e8ej4E3e8ej4E4e8ej4E5e8ej4F1e8ej4F2e8ej4F3e8ej4F4e8ej4F5e8ej4G1e8ej4G2e8ej4G3e8ej4G4e8ej4G5e8ej4H1e8ej4H2e8ej4H3e8ej4H4e8ej4H5e8ej4I1e8ej4I2e8ej4I3e8ej4I4e8ej4I5e8ej4J1e8ej4J2e8ej4J3e8ej4J4e8ej4J5e8ej4K1e8ej4L1e8ej4M1e8ej4N1e8ej4O1e8ej4P1e8ej4Q1e8ej4R1e8ej4S1e8ej4T1
ECOD domains from experimental PDB structures interacting with ligand DB02930
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4A2 | A:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4A4 | A:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4B2 | B:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4B4 | B:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4C2 | C:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4C4 | C:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4D2 | D:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4D4 | D:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4E2 | E:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4E4 | E:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4F2 | F:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4F4 | F:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4G2 | G:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4G4 | G:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4H2 | H:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4H4 | H:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4I2 | I:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4I4 | I:373-455 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4J2 | J:133-372 |
| Q96P20 | DB02930 | AGS | 8ej4 | e8ej4J4 | J:373-455 |