Attributes
UniProt ID
Protein Name
DNA polymerase IV
Ligand Name
THYMIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NHVNXKFIZYSCEB-XLPZGREQSA-N
SMILES
CC1=CN(C(=O)NC1=O)C2CC(C(O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1S0O
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1s0oA1e1s0oA2e1s0oA3e1s0oA4e1s0oB1e1s0oB2e1s0oB3e1s0oB4
ECOD domains from experimental PDB structures interacting with ligand DB02452
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q97W02 | DB02452 | TTP | 1s0o | e1s0oA3 | A:1-20,A:76-176 |
| Q97W02 | DB02452 | TTP | 1s0o | e1s0oA4 | A:21-75 |
| Q97W02 | DB02452 | TTP | 1s0o | e1s0oB3 | B:1-20,B:76-176 |
| Q97W02 | DB02452 | TTP | 1s0o | e1s0oB4 | B:21-75 |
| Q97W02 | DB02452 | TTP | 2w9c | e2w9cA5 | A:1-21,A:77-177 |
| Q97W02 | DB02452 | TTP | 2w9c | e2w9cA7 | A:22-76 |
| Q97W02 | DB02452 | TTP | 2w9c | e2w9cB5 | B:1-21,B:77-177 |
| Q97W02 | DB02452 | TTP | 2w9c | e2w9cB7 | B:22-76 |
| Q97W02 | DB02452 | TTP | 3khl | e3khlA5 | A:1-21,A:77-177 |
| Q97W02 | DB02452 | TTP | 3khl | e3khlA7 | A:22-76 |
| Q97W02 | DB02452 | TTP | 3khl | e3khlB5 | B:1001-1021,B:1077-1177 |
| Q97W02 | DB02452 | TTP | 3khl | e3khlB7 | B:1022-1076 |
| Q97W02 | DB02452 | TTP | 3khr | e3khrA5 | A:1-21,A:77-177 |
| Q97W02 | DB02452 | TTP | 3khr | e3khrA7 | A:22-76 |
| Q97W02 | DB02452 | TTP | 3khr | e3khrB5 | B:1001-1021,B:1077-1177 |
| Q97W02 | DB02452 | TTP | 3khr | e3khrB7 | B:1022-1076 |
| Q97W02 | DB02452 | TTP | 3pw2 | e3pw2A5 | A:1-22,A:78-178 |
| Q97W02 | DB02452 | TTP | 3pw2 | e3pw2A7 | A:23-77 |
| Q97W02 | DB02452 | TTP | 3pw5 | e3pw5A5 | A:1-22,A:78-178 |
| Q97W02 | DB02452 | TTP | 3pw5 | e3pw5A7 | A:23-77 |
| Q97W02 | DB02452 | TTP | 4tqr | e4tqrA2 | A:1-20,A:76-176 |
| Q97W02 | DB02452 | TTP | 4tqr | e4tqrA3 | A:21-75 |
| Q97W02 | DB02452 | TTP | 5edw | e5edwA2 | A:21-75 |
| Q97W02 | DB02452 | TTP | 5edw | e5edwA4 | A:1-20,A:76-176 |