Attributes
UniProt ID
Protein Name
S-methyl-5'-thioadenosine phosphorylase
Ligand Name
5'-DEOXY-5'-METHYLTHIOADENOSINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
WUUGFSXJNOTRMR-IOSLPCCCSA-N
SMILES
CSCC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2A8Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2a8yA1e2a8yB1e2a8yC1e2a8yD1e2a8yE1e2a8yF1e2a8yG1e2a8yH1e2a8yI1e2a8yJ1e2a8yK1e2a8yL1
ECOD domains from experimental PDB structures interacting with ligand DB02282
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yA1 | A:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yB1 | B:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yC1 | C:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yD1 | D:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yE1 | E:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yF1 | F:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yG1 | G:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yH1 | H:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yI1 | I:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yJ1 | J:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yK1 | K:1-270 |
| Q97W94 | DB02282 | MTA | 2a8y | e2a8yL1 | L:1-270 |
| Q97W94 | DB02282 | MTA | 3t94 | e3t94A1 | A:1-270 |
| Q97W94 | DB02282 | MTA | 3t94 | e3t94B1 | B:1-270 |
| Q97W94 | DB02282 | MTA | 3t94 | e3t94C1 | C:1-270 |
| Q97W94 | DB02282 | MTA | 3t94 | e3t94D1 | D:1-270 |
| Q97W94 | DB02282 | MTA | 3t94 | e3t94E1 | E:1-270 |
| Q97W94 | DB02282 | MTA | 3t94 | e3t94F1 | F:1-270 |