Attributes
UniProt ID
Protein Name
Putative aminotransferase
Ligand Name
(2R,3R,4S,5S,6R)-3,5-dihydroxy-4-{[(1E)-{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene]amino}-6-methyltetrahydro-2H-pyran-2-yl [(2R,3S,5R)-3-hydroxy-5-(5-methyl-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)tetrahydrofuran-2-yl]methyl dihydrogen diphosphate
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
UJDWKFAFGYHSFM-HMSDFHDVSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=NC2C(C(OC(C2O)OP(=O)(O)OP(=O)(O)OCC3C(CC(O3)N4C=C(C(=O)NC4=O)C)O)C)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5U21
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5u21A1e5u21A2e5u21B1e5u21B2e5u21C1e5u21C2e5u21D1e5u21D2
ECOD domains from experimental PDB structures interacting with ligand TQP
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9ALS9 | n/a | TQP | 5u21 | e5u21A1 | A:0-21,A:245-360 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21A2 | A:22-244 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21B1 | B:-1-21,B:245-360 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21B2 | B:22-244 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21C1 | C:0-21,C:245-360 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21C2 | C:22-244 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21D1 | D:22-244 |
| Q9ALS9 | n/a | TQP | 5u21 | e5u21D2 | D:0-21,D:245-360 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23A1 | A:0-21,A:245-360 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23A2 | A:22-244 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23B1 | B:22-244 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23B2 | B:-6-21,B:245-360 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23C1 | C:0-21,C:245-360 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23C2 | C:22-244 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23D1 | D:13-244 |
| Q9ALS9 | n/a | TQP | 5u23 | e5u23D2 | D:245-360 |