Attributes
UniProt ID
Protein Name
diphosphomevalonate decarboxylase
Ligand Name
PHOSPHOTHIOPHOSPHORIC ACID-ADENYLATE ESTER
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NLTUCYMLOPLUHL-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=S)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4DPT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4dptA5e4dptA6e4dptB5e4dptB6
ECOD domains from experimental PDB structures interacting with ligand DB02930
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9FD73 | DB02930 | AGS | 4dpt | e4dptB5 | B:2-168 |
| Q9FD73 | DB02930 | AGS | 4dpt | e4dptB6 | B:169-327 |
| Q9FD73 | DB02930 | AGS | 4dpu | e4dpuA5 | A:-2-168 |
| Q9FD73 | DB02930 | AGS | 4dpu | e4dpuA6 | A:169-327 |
| Q9FD73 | DB02930 | AGS | 4dpu | e4dpuB5 | B:2-168 |
| Q9FD73 | DB02930 | AGS | 4dpu | e4dpuB6 | B:169-327 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwA5 | A:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwA6 | A:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwB5 | B:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwB6 | B:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwC5 | C:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwC6 | C:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwD5 | D:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwD6 | D:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwE5 | E:-1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwE6 | E:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwF5 | F:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwF6 | F:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwG5 | G:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwG6 | G:169-326 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwH5 | H:1-168 |
| Q9FD73 | DB02930 | AGS | 4dpw | e4dpwH6 | H:169-326 |