Attributes
UniProt ID
Protein Name
N-alpha-acetyltransferase 50
Ligand Name
COENZYME A
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGJOEKWQDUBAIZ-IBOSZNHHSA-N
SMILES
CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)n2cnc3c2ncnc3N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCS)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2PSW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2pswA1e2pswB1e2pswC1
ECOD domains from experimental PDB structures interacting with ligand DB01992
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9GZZ1 | DB01992 | COA | 2psw | e2pswA1 | A:1-155 |
| Q9GZZ1 | DB01992 | COA | 2psw | e2pswB1 | B:4-155 |
| Q9GZZ1 | DB01992 | COA | 2psw | e2pswC1 | C:4-155 |
| Q9GZZ1 | DB01992 | COA | 3tfy | e3tfyA1 | A:1-155 |
| Q9GZZ1 | DB01992 | COA | 3tfy | e3tfyB1 | B:4-155 |
| Q9GZZ1 | DB01992 | COA | 3tfy | e3tfyC1 | C:4-155 |
| Q9GZZ1 | DB01992 | COA | 4x5k | e4x5kA1 | A:3-155 |
| Q9GZZ1 | DB01992 | COA | 6wf3 | e6wf3A1 | A:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wf3 | e6wf3B1 | B:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wf3 | e6wf3C1 | C:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wf3 | e6wf3D1 | D:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wf3 | e6wf3E1 | E:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wf3 | e6wf3F1 | F:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wfg | e6wfgA1 | A:5-154 |
| Q9GZZ1 | DB01992 | COA | 6wfg | e6wfgC1 | C:3-154 |
| Q9GZZ1 | DB01992 | COA | 6wfg | e6wfgE1 | E:4-154 |
| Q9GZZ1 | DB01992 | COA | 6wfk | e6wfkA1 | A:2-154 |
| Q9GZZ1 | DB01992 | COA | 6wfk | e6wfkB1 | B:3-154 |
| Q9GZZ1 | DB01992 | COA | 6wfk | e6wfkC1 | C:4-154 |