Attributes
UniProt ID
Protein Name
Ubiquitin-like modifier-activating enzyme 5
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3H8V
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3h8vA1e3h8vB1
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9GZZ9 | DB00171 | ATP | 3h8v | e3h8vA1 | A:69-318 |
| Q9GZZ9 | DB00171 | ATP | 6h77 | e6h77A1 | A:36-346 |
| Q9GZZ9 | DB00171 | ATP | 6h77 | e6h77B1 | B:36-346 |
| Q9GZZ9 | DB00171 | ATP | 6h77 | e6h77C1 | C:36-346 |
| Q9GZZ9 | DB00171 | ATP | 6h77 | e6h77D1 | D:36-346 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78A1 | A:36-322 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78B1 | B:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78C1 | C:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78D1 | D:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78E1 | E:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78F1 | F:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78G1 | G:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78H1 | H:36-319 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78I1 | I:36-320 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78J1 | J:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78K1 | K:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78L1 | L:36-320 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78M1 | M:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78N1 | N:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78O1 | O:36-321 |
| Q9GZZ9 | DB00171 | ATP | 6h78 | e6h78P1 | P:36-321 |