Attributes
UniProt ID
Protein Name
Ras-related protein Rab-1B
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4HLQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4hlqA5e4hlqA6e4hlqB1e4hlqC5e4hlqC6e4hlqD1e4hlqE5e4hlqE6e4hlqF1e4hlqG5e4hlqG6e4hlqH1e4hlqI5e4hlqI6e4hlqJ1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9H0U4 | DB04315 | GDP | 4hlq | e4hlqB1 | B:0-160 |
| Q9H0U4 | DB04315 | GDP | 4hlq | e4hlqD1 | D:0-159 |
| Q9H0U4 | DB04315 | GDP | 4hlq | e4hlqF1 | F:0-160 |
| Q9H0U4 | DB04315 | GDP | 4hlq | e4hlqH1 | H:0-159 |
| Q9H0U4 | DB04315 | GDP | 4hlq | e4hlqJ1 | J:0-159 |
| Q9H0U4 | DB04315 | GDP | 4i1o | e4i1oA1 | A:4-180 |
| Q9H0U4 | DB04315 | GDP | 4i1o | e4i1oC1 | C:0-159 |
| Q9H0U4 | DB04315 | GDP | 4i1o | e4i1oE1 | E:0-159 |
| Q9H0U4 | DB04315 | GDP | 4i1o | e4i1oG1 | G:0-159 |
| Q9H0U4 | DB04315 | GDP | 5o74 | e5o74B1 | B:4-173 |
| Q9H0U4 | DB04315 | GDP | 5o74 | e5o74D1 | D:4-173 |
| Q9H0U4 | DB04315 | GDP | 5o74 | e5o74F1 | F:4-173 |
| Q9H0U4 | DB04315 | GDP | 5o74 | e5o74H1 | H:4-173 |
| Q9H0U4 | DB04315 | GDP | 5o74 | e5o74J1 | J:4-173 |
| Q9H0U4 | DB04315 | GDP | 5o74 | e5o74L1 | L:4-173 |
| Q9H0U4 | DB04315 | GDP | 6sku | e6skuB1 | B:2-172 |
| Q9H0U4 | DB04315 | GDP | 8alk | e8alkB1 | B:2-173 |