Attributes
UniProt ID
Protein Name
Transient receptor potential cation channel subfamily V member 6
Ligand Name
1,2-DIOLEOYL-SN-GLYCERO-3-PHOSPHOCHOLINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SNKAWJBJQDLSFF-NVKMUCNASA-O
SMILES
CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCC=CCCCCCCCC
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7K4A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7k4aA1e7k4aA2e7k4aB1e7k4aB2e7k4aC1e7k4aC2e7k4aD1e7k4aD2
ECOD domains from experimental PDB structures interacting with ligand DB03690
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9H1D0 | DB03690 | PCW | 7k4a | e7k4aA2 | A:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4a | e7k4aB2 | B:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4a | e7k4aC2 | C:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4a | e7k4aD2 | D:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4b | e7k4bA1 | A:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4b | e7k4bB1 | B:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4b | e7k4bC1 | C:311-614 |
| Q9H1D0 | DB03690 | PCW | 7k4b | e7k4bD1 | D:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s88 | e7s88D2 | D:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s89 | e7s89A1 | A:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s89 | e7s89B2 | B:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s89 | e7s89C1 | C:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s89 | e7s89D1 | D:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s8b | e7s8bA2 | A:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s8b | e7s8bB2 | B:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s8b | e7s8bC2 | C:311-614 |
| Q9H1D0 | DB03690 | PCW | 7s8b | e7s8bD2 | D:311-614 |
| Q9H1D0 | DB03690 | PCW | 8fob | e8fobA1 | A:311-614 |
| Q9H1D0 | DB03690 | PCW | 8fob | e8fobB1 | B:311-614 |
| Q9H1D0 | DB03690 | PCW | 8fob | e8fobC2 | C:311-614 |
| Q9H1D0 | DB03690 | PCW | 8fob | e8fobD1 | D:311-614 |