Attributes
UniProt ID
Protein Name
Ras-related GTP-binding protein C
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6S6A
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6s6aA1e6s6aA2e6s6aB1e6s6aB2e6s6aC1e6s6aC2e6s6aD1e6s6aD2
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9HB90 | DB04315 | GDP | 6s6a | e6s6aC1 | C:60-83,C:106-237 |
| Q9HB90 | DB04315 | GDP | 6s6a | e6s6aD1 | D:60-83,D:106-237 |
| Q9HB90 | DB04315 | GDP | 6s6d | e6s6dC1 | C:59-237 |
| Q9HB90 | DB04315 | GDP | 6s6d | e6s6dD2 | D:60-83,D:106-237 |
| Q9HB90 | DB04315 | GDP | 6sb0 | e6sb0D1 | D:60-83,D:106-237 |
| Q9HB90 | DB04315 | GDP | 6sb0 | e6sb0J2 | J:60-83,J:106-237 |
| Q9HB90 | DB04315 | GDP | 6sb2 | e6sb2D1 | D:60-83,D:106-237 |
| Q9HB90 | DB04315 | GDP | 6sb2 | e6sb2J2 | J:60-83,J:106-237 |
| Q9HB90 | DB04315 | GDP | 6u62 | e6u62C2 | C:59-84,C:106-237 |
| Q9HB90 | DB04315 | GDP | 7t3b | e7t3bE2 | E:63-237 |
| Q9HB90 | DB04315 | GDP | 7t3c | e7t3cE2 | E:62-237 |
| Q9HB90 | DB04315 | GDP | 7ux2 | e7ux2C2 | C:59-84,C:106-237 |
| Q9HB90 | DB04315 | GDP | 7ux2 | e7ux2J2 | J:59-83,J:106-237 |
| Q9HB90 | DB04315 | GDP | 7uxc | e7uxcE2 | E:59-84,E:106-237 |
| Q9HB90 | DB04315 | GDP | 7uxc | e7uxcL2 | L:59-83,L:106-237 |
| Q9HB90 | DB04315 | GDP | 7uxh | e7uxhG1 | G:59-84,G:106-237 |
| Q9HB90 | DB04315 | GDP | 7uxh | e7uxhN1 | N:59-83,N:106-237 |
| Q9HB90 | DB04315 | GDP | 7uxh | e7uxhW1 | W:59-84,W:106-237 |
| Q9HB90 | DB04315 | GDP | 7uxh | e7uxhd2 | d:59-83,d:106-237 |