Attributes
UniProt ID
Protein Name
Guanylate kinase
Ligand Name
GUANOSINE-5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RQFCJASXJCIDSX-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7U5F
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7u5fA1e7u5fB1e7u5fC1e7u5fD1
ECOD domains from experimental PDB structures interacting with ligand DB01972
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9HTM2 | DB01972 | 5GP | 7u5f | e7u5fA1 | A:2-204 |
| Q9HTM2 | DB01972 | 5GP | 7u5f | e7u5fB1 | B:2-204 |
| Q9HTM2 | DB01972 | 5GP | 7u5f | e7u5fC1 | C:2-203 |
| Q9HTM2 | DB01972 | 5GP | 7u5f | e7u5fD1 | D:2-204 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglA1 | A:2-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglB1 | B:2-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglC1 | C:2-204 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglD1 | D:2-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglE1 | E:2-204 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglF1 | F:2-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglG1 | G:2-204 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglH1 | H:2-204 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglI1 | I:2-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglJ1 | J:2-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglK1 | K:3-203 |
| Q9HTM2 | DB01972 | 5GP | 8egl | e8eglL1 | L:2-204 |