Attributes
UniProt ID
Protein Name
Bacterioferritin BfrB
Ligand Name
2-(N-MORPHOLINO)-ETHANESULFONIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
SXGZJKUKBWWHRA-UHFFFAOYSA-N
SMILES
C1COCC[NH+]1CCS(=O)(=O)[O-]
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4TOB
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4tobA1e4tobB1e4tobC1e4tobD1e4tobE1e4tobF1e4tobG1e4tobH1e4tobI1e4tobJ1e4tobK1e4tobL1e4tobM1e4tobN1e4tobO1e4tobP1e4tobQ1e4tobR1e4tobS1e4tobT1e4tobU1e4tobV1e4tobW1e4tobX1
ECOD domains from experimental PDB structures interacting with ligand DB03814
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9HY79 | DB03814 | MES | 4tob | e4tobA1 | A:1-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobB1 | B:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobC1 | C:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobD1 | D:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobE1 | E:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobF1 | F:2-157 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobG1 | G:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobH1 | H:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobI1 | I:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobJ1 | J:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobK1 | K:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobL1 | L:3-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobM1 | M:3-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobN1 | N:1-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobO1 | O:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobP1 | P:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobQ1 | Q:3-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobR1 | R:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobS1 | S:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobT1 | T:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobU1 | U:3-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobV1 | V:2-156 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobW1 | W:2-157 |
| Q9HY79 | DB03814 | MES | 4tob | e4tobX1 | X:2-156 |