Attributes
UniProt ID
Protein Name
Uridine phosphorylase
Ligand Name
URIDINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
DRTQHJPVMGBUCF-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5C80
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5c80A1e5c80B1e5c80C1e5c80D1e5c80E1e5c80F1
ECOD domains from experimental PDB structures interacting with ligand DB02745
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9K4U1 | DB02745 | URI | 5c80 | e5c80A1 | A:3-253 |
| Q9K4U1 | DB02745 | URI | 5c80 | e5c80B1 | B:2-253 |
| Q9K4U1 | DB02745 | URI | 5c80 | e5c80C1 | C:3-253 |
| Q9K4U1 | DB02745 | URI | 5c80 | e5c80D1 | D:3-253 |
| Q9K4U1 | DB02745 | URI | 5c80 | e5c80E1 | E:3-253 |
| Q9K4U1 | DB02745 | URI | 5c80 | e5c80F1 | F:3-253 |
| Q9K4U1 | DB02745 | URI | 5lhv | e5lhvA1 | A:3-253 |
| Q9K4U1 | DB02745 | URI | 5lhv | e5lhvB1 | B:3-253 |
| Q9K4U1 | DB02745 | URI | 5lhv | e5lhvC1 | C:3-253 |
| Q9K4U1 | DB02745 | URI | 5lhv | e5lhvD1 | D:3-253 |
| Q9K4U1 | DB02745 | URI | 5lhv | e5lhvE1 | E:3-253 |
| Q9K4U1 | DB02745 | URI | 5lhv | e5lhvF1 | F:3-253 |
| Q9K4U1 | DB02745 | URI | 5m2t | e5m2tA1 | A:3-253 |
| Q9K4U1 | DB02745 | URI | 5m2t | e5m2tB1 | B:2-253 |
| Q9K4U1 | DB02745 | URI | 5m2t | e5m2tC1 | C:3-253 |
| Q9K4U1 | DB02745 | URI | 5m2t | e5m2tD1 | D:2-253 |
| Q9K4U1 | DB02745 | URI | 5m2t | e5m2tE1 | E:2-253 |
| Q9K4U1 | DB02745 | URI | 5m2t | e5m2tF1 | F:3-253 |