Attributes
UniProt ID
Protein Name
Histone-lysine N-methyltransferase ASH1L
Ligand Name
S-ADENOSYLMETHIONINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MEFKEPWMEQBLKI-FCKMPRQPSA-N
SMILES
C[S+](CCC(C(=O)[O-])N)CC1C(C(C(O1)n2cnc3c2ncnc3N)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3OPE
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3opeA1e3opeA2e3opeB2e3opeB3
ECOD domains from experimental PDB structures interacting with ligand DB00118
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9NR48 | DB00118 | SAM | 3ope | e3opeA1 | A:2138-2280 |
| Q9NR48 | DB00118 | SAM | 3ope | e3opeB2 | B:2138-2279 |
| Q9NR48 | DB00118 | SAM | 4ynm | e4ynmA1 | A:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ynm | e4ynmB2 | B:2138-2279 |
| Q9NR48 | DB00118 | SAM | 4ynp | e4ynpA2 | A:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ynp | e4ynpB2 | B:2138-2279 |
| Q9NR48 | DB00118 | SAM | 4ypa | e4ypaA2 | A:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ypa | e4ypaB2 | B:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ypa | e4ypaC1 | C:2138-2279 |
| Q9NR48 | DB00118 | SAM | 4ypa | e4ypaD2 | D:2138-2279 |
| Q9NR48 | DB00118 | SAM | 4ype | e4ypeA2 | A:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ype | e4ypeB1 | B:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ypu | e4ypuA1 | A:2138-2280 |
| Q9NR48 | DB00118 | SAM | 4ypu | e4ypuB1 | B:2138-2279 |
| Q9NR48 | DB00118 | SAM | 6wzw | e6wzwA2 | A:2138-2283 |
| Q9NR48 | DB00118 | SAM | 6x0p | e6x0pA1 | A:2138-2281 |
| Q9NR48 | DB00118 | SAM | 6x0p | e6x0pB2 | B:2138-2282 |
| Q9NR48 | DB00118 | SAM | 6x0p | e6x0pC2 | C:2138-2282 |
| Q9NR48 | DB00118 | SAM | 6x0p | e6x0pD1 | D:2138-2282 |