Attributes
UniProt ID
Protein Name
Mitochondrial potassium channel ATP-binding subunit
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 5OCH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse5ochA1e5ochA2e5ochB1e5ochB2e5ochC1e5ochC2e5ochD1e5ochD2e5ochE1e5ochE2e5ochF1e5ochF2e5ochG1e5ochG2e5ochH1e5ochH2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9NUT2 | DB16833 | ADP | 5och | e5ochA1 | A:455-718 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochA2 | A:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochB1 | B:455-718 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochB2 | B:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochC1 | C:455-718 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochC2 | C:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochD1 | D:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochD2 | D:455-713 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochE1 | E:455-716 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochE2 | E:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochF1 | F:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochF2 | F:455-712 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochG1 | G:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochG2 | G:455-717 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochH1 | H:132-454 |
| Q9NUT2 | DB16833 | ADP | 5och | e5ochH2 | H:455-713 |