Attributes
UniProt ID
Protein Name
Nicotinamide riboside kinase 1
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2QL6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2ql6A1e2ql6B1e2ql6C1e2ql6D1e2ql6E1e2ql6F1e2ql6G1e2ql6H1e2ql6I1e2ql6J1e2ql6K1e2ql6L1e2ql6M1e2ql6N1e2ql6O1e2ql6P1
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6A1 | A:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6B1 | B:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6C1 | C:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6D1 | D:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6E1 | E:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6F1 | F:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6G1 | G:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6H1 | H:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6I1 | I:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6J1 | J:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6K1 | K:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6L1 | L:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6M1 | M:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6N1 | N:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6O1 | O:2-192 |
| Q9NWW6 | DB16833 | ADP | 2ql6 | e2ql6P1 | P:2-192 |
| Q9NWW6 | DB16833 | ADP | 2qsy | e2qsyA1 | A:1-189 |