Attributes
UniProt ID
Protein Name
3-ketosteroid dehydrogenase
Ligand Name
ANDROSTA-1,4-DIENE-3,17-DIONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
LUJVUUWNAPIQQI-QAGGRKNESA-N
SMILES
CC12CCC3C(C1CCC2=O)CCC4=CC(=O)C=CC34C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4C3Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4c3yA7e4c3yA8e4c3yA9e4c3yB7e4c3yB8e4c3yB9e4c3yC4e4c3yC5e4c3yC6e4c3yD7e4c3yD8e4c3yD9e4c3yE7e4c3yE8e4c3yE9e4c3yF7e4c3yF8e4c3yF9e4c3yG7e4c3yG8e4c3yG9e4c3yH7e4c3yH8e4c3yH9
ECOD domains from experimental PDB structures interacting with ligand DB07373
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yA7 | A:277-372,A:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yA9 | A:3-276,A:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yB7 | B:277-372,B:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yB9 | B:3-276,B:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yC4 | C:277-372,C:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yC6 | C:3-276,C:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yD7 | D:277-372,D:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yD9 | D:3-276,D:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yE7 | E:277-372,E:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yE9 | E:3-276,E:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yF7 | F:277-372,F:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yF9 | F:3-276,F:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yG7 | G:277-372,G:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yG9 | G:3-276,G:449-510 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yH7 | H:277-372,H:403-448 |
| Q9RA02 | DB07373 | ANB | 4c3y | e4c3yH9 | H:3-276,H:449-510 |
| Q9RA02 | DB07373 | ANB | 8kcz | e8kczA1 | A:6-294,A:467-528 |
| Q9RA02 | DB07373 | ANB | 8kcz | e8kczA3 | A:295-390,A:421-466 |