Attributes
UniProt ID
Protein Name
Mannosylglycerate synthase
Ligand Name
GUANOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QGWNDRXFNXRZMB-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2BO7
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2bo7A1e2bo7B1e2bo7C1e2bo7D1e2bo7E1e2bo7F1e2bo7G1e2bo7H1e2bo7I1e2bo7J1
ECOD domains from experimental PDB structures interacting with ligand DB04315
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7A1 | A:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7B1 | B:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7C1 | C:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7D1 | D:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7E1 | E:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7F1 | F:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7G1 | G:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7H1 | H:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7I1 | I:2-382 |
| Q9RFR0 | DB04315 | GDP | 2bo7 | e2bo7J1 | J:2-382 |
| Q9RFR0 | DB04315 | GDP | 2y4k | e2y4kA1 | A:2-381 |
| Q9RFR0 | DB04315 | GDP | 2y4k | e2y4kB1 | B:2-382 |
| Q9RFR0 | DB04315 | GDP | 2y4l | e2y4lA1 | A:2-381 |
| Q9RFR0 | DB04315 | GDP | 2y4l | e2y4lB1 | B:2-381 |