Attributes
UniProt ID
Protein Name
HAD superfamily Cof-like phosphohydrolase
Ligand Name
2'-DEOXYURIDINE 5'-MONOPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
JSRLJPSBLDHEIO-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=O)NC2=O)COP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2YFC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2yfcA2e2yfcB3e2yfcC2e2yfcD3
ECOD domains from experimental PDB structures interacting with ligand DB03800
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9RS96 | DB03800 | UMP | 2yfc | e2yfcA2 | A:7-144 |
| Q9RS96 | DB03800 | UMP | 2yfc | e2yfcB3 | B:7-145 |
| Q9RS96 | DB03800 | UMP | 2yfc | e2yfcC2 | C:7-143 |
| Q9RS96 | DB03800 | UMP | 2yfc | e2yfcD3 | D:7-144 |
| Q9RS96 | DB03800 | UMP | 2yfd | e2yfdA2 | A:7-145 |
| Q9RS96 | DB03800 | UMP | 2yfd | e2yfdB3 | B:7-144 |
| Q9RS96 | DB03800 | UMP | 2yfd | e2yfdC2 | C:6-143 |
| Q9RS96 | DB03800 | UMP | 2yfd | e2yfdD3 | D:6-144 |
| Q9RS96 | DB03800 | UMP | 5hx1 | e5hx1A1 | A:7-144 |
| Q9RS96 | DB03800 | UMP | 5hx1 | e5hx1B1 | B:7-144 |
| Q9RS96 | DB03800 | UMP | 5hx1 | e5hx1C1 | C:7-144 |
| Q9RS96 | DB03800 | UMP | 5hx1 | e5hx1D1 | D:7-144 |
| Q9RS96 | DB03800 | UMP | 5hzz | e5hzzA1 | A:7-144 |
| Q9RS96 | DB03800 | UMP | 5hzz | e5hzzB1 | B:6-144 |
| Q9RS96 | DB03800 | UMP | 5hzz | e5hzzC1 | C:-4-144 |
| Q9RS96 | DB03800 | UMP | 5hzz | e5hzzD1 | D:-4-144 |
| Q9RS96 | DB03800 | UMP | 5i0j | e5i0jA1 | A:5-144 |
| Q9RS96 | DB03800 | UMP | 5i0j | e5i0jB1 | B:7-144 |
| Q9RS96 | DB03800 | UMP | 5i0j | e5i0jC1 | C:7-144 |
| Q9RS96 | DB03800 | UMP | 5i0j | e5i0jD1 | D:5-144 |
| Q9RS96 | DB03800 | UMP | 5i0m | e5i0mA1 | A:7-144 |
| Q9RS96 | DB03800 | UMP | 5i0m | e5i0mB1 | B:7-144 |
| Q9RS96 | DB03800 | UMP | 5i0m | e5i0mC1 | C:7-111,C:131-143 |
| Q9RS96 | DB03800 | UMP | 5i0m | e5i0mD1 | D:7-111,D:131-143 |