Attributes
UniProt ID
Protein Name
Branched-chain-amino-acid aminotransferase
Ligand Name
PYRIDOXAL-5'-PHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NGVDGCNFYWLIFO-UHFFFAOYSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)C=O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3UYY
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3uyyA3e3uyyA4e3uyyB1e3uyyB3
ECOD domains from experimental PDB structures interacting with ligand DB00114
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9RTX5 | DB00114 | PLP | 3uyy | e3uyyA3 | A:178-358 |
| Q9RTX5 | DB00114 | PLP | 3uyy | e3uyyA4 | A:24-177 |
| Q9RTX5 | DB00114 | PLP | 3uyy | e3uyyB1 | B:175-358 |
| Q9RTX5 | DB00114 | PLP | 3uyy | e3uyyB3 | B:22-174 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbA3 | A:175-358 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbA4 | A:24-174 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbB3 | B:175-358 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbB4 | B:24-174 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbC3 | C:175-358 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbC4 | C:24-174 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbD3 | D:175-358 |
| Q9RTX5 | DB00114 | PLP | 3uzb | e3uzbD4 | D:24-174 |
| Q9RTX5 | DB00114 | PLP | 3uzo | e3uzoA3 | A:175-358 |
| Q9RTX5 | DB00114 | PLP | 3uzo | e3uzoA4 | A:24-174 |
| Q9RTX5 | DB00114 | PLP | 3uzo | e3uzoB3 | B:176-358 |
| Q9RTX5 | DB00114 | PLP | 3uzo | e3uzoB4 | B:24-175 |