Attributes
UniProt ID
Protein Name
UDP-galactopyranose mutase
Ligand Name
GALACTOSE-URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
HSCJRCZFDFQWRP-ABVWGUQPSA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3HDQ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3hdqA1e3hdqB1e3hdqC1e3hdqD1e3hdqE1e3hdqF1e3hdqG1e3hdqH1e3hdqI1e3hdqJ1
ECOD domains from experimental PDB structures interacting with ligand DB03501
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqA1 | A:25-389 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqB1 | B:27-390 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqC1 | C:28-388 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqD1 | D:29-388 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqE1 | E:26-389 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqF1 | F:28-390 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqG1 | G:27-389 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqH1 | H:27-390 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqI1 | I:27-389 |
| Q9RYF1 | DB03501 | GDU | 3hdq | e3hdqJ1 | J:29-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyA1 | A:25-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyB1 | B:29-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyC1 | C:33-381 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyD1 | D:29-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyE1 | E:29-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyF1 | F:28-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyG1 | G:29-388 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyH1 | H:28-388 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyI1 | I:29-389 |
| Q9RYF1 | DB03501 | GDU | 3hdy | e3hdyJ1 | J:30-388 |