Attributes
UniProt ID
Protein Name
UDP-galactopyranose mutase
Ligand Name
URIDINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XCCTYIAWTASOJW-XVFCMESISA-N
SMILES
C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3HE3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3he3A1e3he3B1e3he3C1e3he3D1e3he3E1e3he3F1e3he3G1e3he3H1e3he3I1e3he3J1
ECOD domains from experimental PDB structures interacting with ligand DB03435
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3A1 | A:25-390 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3B1 | B:27-390 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3C1 | C:28-389 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3D1 | D:28-389 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3E1 | E:26-389 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3F1 | F:28-390 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3G1 | G:28-390 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3H1 | H:28-390 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3I1 | I:27-390 |
| Q9RYF1 | DB03435 | UDP | 3he3 | e3he3J1 | J:29-389 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4A1 | A:25-389 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4B1 | B:28-390 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4C1 | C:28-390 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4E1 | E:29-389 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4F1 | F:28-391 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4G1 | G:27-389 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4H1 | H:27-390 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4I1 | I:26-389 |
| Q9RYF1 | DB03435 | UDP | 3mj4 | e3mj4J1 | J:27-389 |