Attributes
UniProt ID
Protein Name
Receptor-like protein kinase HSL1
Ligand Name
2-acetamido-2-deoxy-beta-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
OVRNDRQMDRJTHS-FMDGEEDCSA-N
SMILES
CC(=O)NC1C(C(C(OC1O)CO)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7ODK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7odkAAA1e7odkBBB1e7odkBBB2
ECOD domains from experimental PDB structures interacting with ligand DB00141
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9SGP2 | DB00141 | NAG | 7odk | e7odkAAA1 | AAA:18-606 |
| Q9SGP2 | DB00141 | NAG | 7odk | e7odkBBB1 | BBB:17-319 |
| Q9SGP2 | DB00141 | NAG | 7odk | e7odkBBB2 | BBB:320-601 |
| Q9SGP2 | DB00141 | NAG | 7odv | e7odvAAA1 | AAA:320-606 |
| Q9SGP2 | DB00141 | NAG | 7odv | e7odvAAA2 | AAA:13-319 |
| Q9SGP2 | DB00141 | NAG | 7odv | e7odvDDD1 | DDD:320-606 |
| Q9SGP2 | DB00141 | NAG | 7odv | e7odvDDD2 | DDD:12-319 |
| Q9SGP2 | DB00141 | NAG | 7ogo | e7ogoAAA1 | AAA:13-319 |
| Q9SGP2 | DB00141 | NAG | 7ogo | e7ogoAAA2 | AAA:320-598 |
| Q9SGP2 | DB00141 | NAG | 7ogo | e7ogoDDD1 | DDD:13-319 |
| Q9SGP2 | DB00141 | NAG | 7ogo | e7ogoDDD2 | DDD:320-599 |
| Q9SGP2 | DB00141 | NAG | 7ogq | e7ogqAAA1 | AAA:320-606 |
| Q9SGP2 | DB00141 | NAG | 7ogq | e7ogqAAA2 | AAA:12-319 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguAAA1 | AAA:13-319 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguAAA2 | AAA:320-606 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguDDD1 | DDD:320-606 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguDDD2 | DDD:13-319 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguGGG1 | GGG:320-606 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguGGG2 | GGG:13-319 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguJJJ1 | JJJ:13-319 |
| Q9SGP2 | DB00141 | NAG | 7ogu | e7oguJJJ2 | JJJ:320-605 |
| Q9SGP2 | DB00141 | NAG | 7ogz | e7ogzAAA1 | AAA:14-606 |
| Q9SGP2 | DB00141 | NAG | 7ogz | e7ogzDDD1 | DDD:15-606 |