Attributes
UniProt ID
Protein Name
Spastin
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6PEK
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6pekA1e6pekA2e6pekB1e6pekB2e6pekC1e6pekC2e6pekD1e6pekD2e6pekE1e6pekE2
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekA1 | A:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekA2 | A:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekB1 | B:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekB2 | B:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekC1 | C:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekC2 | C:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekD1 | D:318-507 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekD2 | D:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekE1 | E:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pek | e6pekE2 | E:508-554,E:597-610 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penA1 | A:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penA2 | A:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penB1 | B:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penB2 | B:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penC1 | C:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penC2 | C:323-507 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penD1 | D:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penD2 | D:318-507 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penE1 | E:508-610 |
| Q9UBP0 | DB16833 | ADP | 6pen | e6penE2 | E:323-507 |