Attributes
UniProt ID
Protein Name
DNA polymerase iota
Ligand Name
2'-DEOXYCYTIDINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
RGWHQCVHVJXOKC-SHYZEUOFSA-N
SMILES
C1C(C(OC1N2C=CC(=NC2=O)N)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2ALZ
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2alzA1e2alzA2e2alzA3e2alzA4
ECOD domains from experimental PDB structures interacting with ligand DB03258
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9UNA4 | DB03258 | DCP | 2alz | e2alzA3 | A:27-47,A:98-233 |
| Q9UNA4 | DB03258 | DCP | 2alz | e2alzA4 | A:48-97 |
| Q9UNA4 | DB03258 | DCP | 2dpi | e2dpiA3 | A:27-47,A:98-233 |
| Q9UNA4 | DB03258 | DCP | 2dpi | e2dpiA4 | A:48-97 |
| Q9UNA4 | DB03258 | DCP | 3epg | e3epgA13 | A:49-98 |
| Q9UNA4 | DB03258 | DCP | 3epg | e3epgA14 | A:25-48,A:99-234 |
| Q9UNA4 | DB03258 | DCP | 3ngd | e3ngdA13 | A:49-98 |
| Q9UNA4 | DB03258 | DCP | 3ngd | e3ngdA14 | A:26-48,A:99-234 |
| Q9UNA4 | DB03258 | DCP | 3q8p | e3q8pB3 | B:27-47,B:98-233 |
| Q9UNA4 | DB03258 | DCP | 3q8p | e3q8pB4 | B:48-97 |
| Q9UNA4 | DB03258 | DCP | 4eyh | e4eyhB1 | B:49-98 |
| Q9UNA4 | DB03258 | DCP | 4eyh | e4eyhB5 | B:26-48,B:99-234 |
| Q9UNA4 | DB03258 | DCP | 4fs2 | e4fs2A13 | A:49-98 |
| Q9UNA4 | DB03258 | DCP | 4fs2 | e4fs2A14 | A:26-48,A:99-234 |