Attributes
UniProt ID
Protein Name
Thermosome subunit beta
Ligand Name
ADENOSINE-5'-DIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XTWYTFMLZFPYCI-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4XCD
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4xcdA1e4xcdA2e4xcdA3e4xcdB1e4xcdB2e4xcdB3e4xcdC1e4xcdC2e4xcdC3e4xcdD1e4xcdD2e4xcdD3e4xcdE1e4xcdE2e4xcdE3e4xcdF1e4xcdF2e4xcdF3
ECOD domains from experimental PDB structures interacting with ligand DB16833
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdA1 | A:30-155,A:415-540 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdA2 | A:156-226,A:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdB2 | B:156-226,B:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdB3 | B:30-155,B:415-535 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdC2 | C:156-226,C:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdC3 | C:30-155,C:415-536 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdD1 | D:30-155,D:415-534 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdD2 | D:156-226,D:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdE2 | E:156-226,E:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdE3 | E:29-155,E:415-536 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdF1 | F:30-155,F:415-535 |
| Q9V2T8 | DB16833 | ADP | 4xcd | e4xcdF2 | F:156-226,F:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcg | e4xcgB1 | B:156-226,B:379-414 |
| Q9V2T8 | DB16833 | ADP | 4xcg | e4xcgB2 | B:30-155,B:415-535 |
| Q9V2T8 | DB16833 | ADP | 6xhi | e6xhiA1 | A:21-152,A:412-531 |