Attributes
UniProt ID
Protein Name
CTP synthase
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7DPT
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7dptA1e7dptA2e7dptB1e7dptB2e7dptC1e7dptC2e7dptD1e7dptD2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptA1 | A:1-272 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptA2 | A:297-556 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptB1 | B:1-272 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptB2 | B:297-556 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptC1 | C:1-272 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptC2 | C:297-556 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptD1 | D:1-272 |
| Q9VUL1 | DB04137 | GTP | 7dpt | e7dptD2 | D:297-556 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4A1 | A:1-286 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4A2 | A:287-556 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4B1 | B:287-556 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4B2 | B:1-286 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4C1 | C:287-556 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4C2 | C:1-286 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4D1 | D:1-286 |
| Q9VUL1 | DB04137 | GTP | 7wj4 | e7wj4D2 | D:287-556 |