Attributes
UniProt ID
Protein Name
Origin recognition complex subunit 4
Ligand Name
ADENOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZKHQWZAMYRWXGA-KQYNXXCUSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7JGR
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7jgrB1e7jgrB2e7jgrD1e7jgrD2e7jgrD3e7jgrE1e7jgrE2e7jgrE3e7jgrG1e7jgrG2e7jgrG3
ECOD domains from experimental PDB structures interacting with ligand DB00171
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9W102 | DB00171 | ATP | 7jgr | e7jgrD2 | D:210-333 |
| Q9W102 | DB00171 | ATP | 7jgr | e7jgrD3 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jgs | e7jgsD1 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jgs | e7jgsD3 | D:210-333 |
| Q9W102 | DB00171 | ATP | 7jk2 | e7jk2D1 | D:210-333 |
| Q9W102 | DB00171 | ATP | 7jk2 | e7jk2D2 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jk3 | e7jk3D2 | D:210-333 |
| Q9W102 | DB00171 | ATP | 7jk3 | e7jk3D3 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jk4 | e7jk4D1 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jk4 | e7jk4D3 | D:210-333 |
| Q9W102 | DB00171 | ATP | 7jk5 | e7jk5D1 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jk5 | e7jk5D3 | D:210-333 |
| Q9W102 | DB00171 | ATP | 7jk6 | e7jk6D1 | D:2-209 |
| Q9W102 | DB00171 | ATP | 7jk6 | e7jk6D3 | D:210-333 |