Attributes
UniProt ID
Protein Name
Transient receptor potential cation channel subfamily V member 2
Ligand Name
cannabidiol
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
QHMBSVQNZZTUGM-ZWKOTPCHSA-N
SMILES
CCCCCc1cc(c(c(c1)O)C2C=C(CCC2C(=C)C)C)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 6U88
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse6u88A1e6u88A2e6u88B1e6u88B2e6u88C1e6u88C2e6u88D1e6u88D2
ECOD domains from experimental PDB structures interacting with ligand DB09061
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9WUD2 | DB09061 | P0T | 6u88 | e6u88A1 | A:376-561,A:591-729 |
| Q9WUD2 | DB09061 | P0T | 6u88 | e6u88B1 | B:376-561,B:591-729 |
| Q9WUD2 | DB09061 | P0T | 6u88 | e6u88C1 | C:376-561,C:591-729 |
| Q9WUD2 | DB09061 | P0T | 6u88 | e6u88D1 | D:376-561,D:591-729 |
| Q9WUD2 | DB09061 | P0T | 6u8a | e6u8aA2 | A:376-561,A:591-719 |
| Q9WUD2 | DB09061 | P0T | 6u8a | e6u8aB1 | B:376-561,B:591-719 |
| Q9WUD2 | DB09061 | P0T | 6u8a | e6u8aC1 | C:376-561,C:591-719 |
| Q9WUD2 | DB09061 | P0T | 6u8a | e6u8aD1 | D:376-561,D:591-719 |
| Q9WUD2 | DB09061 | P0T | 7t37 | e7t37A1 | A:376-561,A:591-720 |
| Q9WUD2 | DB09061 | P0T | 7t37 | e7t37B2 | B:376-561,B:591-720 |
| Q9WUD2 | DB09061 | P0T | 7t37 | e7t37C2 | C:376-561,C:591-720 |
| Q9WUD2 | DB09061 | P0T | 7t37 | e7t37D2 | D:376-561,D:591-720 |
| Q9WUD2 | DB09061 | P0T | 8slx | e8slxA1 | A:376-560,A:590-728 |
| Q9WUD2 | DB09061 | P0T | 8slx | e8slxB1 | B:376-560,B:590-728 |
| Q9WUD2 | DB09061 | P0T | 8slx | e8slxC1 | C:376-560,C:590-728 |
| Q9WUD2 | DB09061 | P0T | 8slx | e8slxD2 | D:376-560,D:590-728 |
| Q9WUD2 | DB09061 | P0T | 8sly | e8slyA1 | A:376-560,A:591-728 |
| Q9WUD2 | DB09061 | P0T | 8sly | e8slyB2 | B:376-560,B:591-728 |
| Q9WUD2 | DB09061 | P0T | 8sly | e8slyC2 | C:376-560,C:591-728 |
| Q9WUD2 | DB09061 | P0T | 8sly | e8slyD1 | D:376-560,D:591-728 |