Attributes
UniProt ID
Protein Name
Amino acid ABC transporter, periplasmic amino acid-binding protein
Ligand Name
ARGININE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ODKSFYDXXFIFQN-BYPYZUCNSA-O
SMILES
C(CC(C(=O)O)N)CNC(=[NH2+])N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4PSH
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4pshA1e4pshA2e4pshB1e4pshB2
ECOD domains from experimental PDB structures interacting with ligand DB00125
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9WZ62 | DB00125 | ARG | 4psh | e4pshA1 | A:2-94,A:189-226 |
| Q9WZ62 | DB00125 | ARG | 4psh | e4pshA2 | A:95-188 |
| Q9WZ62 | DB00125 | ARG | 4psh | e4pshB1 | B:95-188 |
| Q9WZ62 | DB00125 | ARG | 4psh | e4pshB2 | B:1-94,B:189-226 |
| Q9WZ62 | DB00125 | ARG | 6ggv | e6ggvA1 | A:21-113,A:208-232 |
| Q9WZ62 | DB00125 | ARG | 6ggv | e6ggvA2 | A:114-207 |
| Q9WZ62 | DB00125 | ARG | 6ggv | e6ggvB1 | B:20-113,B:208-232 |
| Q9WZ62 | DB00125 | ARG | 6ggv | e6ggvB2 | B:114-207 |
| Q9WZ62 | DB00125 | ARG | 6gpc | e6gpcA1 | A:1-126 |
| Q9WZ62 | DB00125 | ARG | 6gpc | e6gpcB1 | B:1-126 |
| Q9WZ62 | DB00125 | ARG | 6q3u | e6q3uA1 | A:114-207 |
| Q9WZ62 | DB00125 | ARG | 6q3u | e6q3uA2 | A:20-113,A:208-232 |
| Q9WZ62 | DB00125 | ARG | 6svf | e6svfA1 | A:19-113,A:208-247 |
| Q9WZ62 | DB00125 | ARG | 6svf | e6svfA2 | A:114-207 |
| Q9WZ62 | DB00125 | ARG | 7a99 | e7a99A1 | A:1-129 |
| Q9WZ62 | DB00125 | ARG | 7a99 | e7a99B1 | B:1-130 |