Attributes
UniProt ID
Protein Name
Type III pantothenate kinase
Ligand Name
PANTOTHENOIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
GHOKWGTUZJEAQD-ZETCQYMHSA-N
SMILES
CC(C)(CO)C(C(=O)NCCC(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3BEX
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3bexA1e3bexA2e3bexB1e3bexB2e3bexC1e3bexC2e3bexD1e3bexD2e3bexE1e3bexE2e3bexF1e3bexF2
ECOD domains from experimental PDB structures interacting with ligand DB01783
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexA1 | A:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexA2 | A:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexB1 | B:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexB2 | B:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexC1 | C:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexC2 | C:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexD1 | D:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexD2 | D:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexE1 | E:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexE2 | E:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexF1 | F:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bex | e3bexF2 | F:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1A1 | A:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1A2 | A:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1B1 | B:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1B2 | B:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1C1 | C:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1C2 | C:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1D1 | D:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1D2 | D:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1E1 | E:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1E2 | E:119-245 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1F1 | F:1-118 |
| Q9WZY5 | DB01783 | PAU | 3bf1 | e3bf1F2 | F:119-245 |