Attributes
UniProt ID
Protein Name
hydrogenase maturase subunit HydE
Ligand Name
S-ADENOSYL-L-HOMOCYSTEINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ZJUKTBDSGOFHSH-WFMPWKQPSA-N
SMILES
c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CSCCC(C(=O)O)N)O)O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 3CIW
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse3ciwA1
ECOD domains from experimental PDB structures interacting with ligand DB01752
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9X0Z6 | DB01752 | SAH | 3ciw | e3ciwA1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 3cix | e3cixA1 | A:2-347 |
| Q9X0Z6 | DB01752 | SAH | 4jy9 | e4jy9A1 | A:1-346 |
| Q9X0Z6 | DB01752 | SAH | 4jyd | e4jydA1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 4jye | e4jyeA1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 4jyf | e4jyfA1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 5few | e5fewA1 | A:2-347 |
| Q9X0Z6 | DB01752 | SAH | 5ff2 | e5ff2A1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 5ff3 | e5ff3A1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 5ff4 | e5ff4A1 | A:2-347 |
| Q9X0Z6 | DB01752 | SAH | 7o1o | e7o1oA1 | A:-9-346 |
| Q9X0Z6 | DB01752 | SAH | 7o1p | e7o1pA1 | A:2-334 |
| Q9X0Z6 | DB01752 | SAH | 7o1s | e7o1sA1 | A:1-347 |
| Q9X0Z6 | DB01752 | SAH | 8qmk | e8qmkA1 | A:-9-346 |
| Q9X0Z6 | DB01752 | SAH | 8qml | e8qmlA1 | A:2-347 |
| Q9X0Z6 | DB01752 | SAH | 8qmm | e8qmmA1 | A:-9-346 |
| Q9X0Z6 | DB01752 | SAH | 8qmn | e8qmnA1 | A:-9-346 |