Attributes
UniProt ID
Protein Name
6-phospho-beta-glucosidase BglT
Ligand Name
6-O-phosphono-alpha-D-glucopyranose
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
NBSCHQHZLSJFNQ-DVKNGEFBSA-N
SMILES
C(C1C(C(C(C(O1)O)O)O)O)OP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1UP6
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1up6A1e1up6A2e1up6B1e1up6B2e1up6C1e1up6C2e1up6D1e1up6D2e1up6E1e1up6E2e1up6F1e1up6F2e1up6G1e1up6G2e1up6H1e1up6H2
ECOD domains from experimental PDB structures interacting with ligand DB02007
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9X108 | DB02007 | G6P | 1up6 | e1up6A1 | A:163-415 |
| Q9X108 | DB02007 | G6P | 1up6 | e1up6A2 | A:2-162 |
| Q9X108 | DB02007 | G6P | 1up6 | e1up6C1 | C:163-415 |
| Q9X108 | DB02007 | G6P | 1up6 | e1up6C2 | C:2-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7A1 | A:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7A2 | A:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7B1 | B:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7B2 | B:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7C1 | C:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7C2 | C:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7D1 | D:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7D2 | D:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7E1 | E:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7E2 | E:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7F1 | F:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7F2 | F:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7G1 | G:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7G2 | G:1-162 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7H1 | H:163-415 |
| Q9X108 | DB02007 | G6P | 1up7 | e1up7H2 | H:1-162 |