Attributes
UniProt ID
Protein Name
Putative outer membrane lipoprotein Wza
Ligand Name
S-[(1-oxyl-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrol-3-yl)methyl] methanesulfonothioate
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
MXZPGYFBZHBAQM-UHFFFAOYSA-N
SMILES
CC1(C=C(C(N1[O])(C)C)CSS(=O)(=O)C)C
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 2W8H
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse2w8hA1e2w8hA2e2w8hA3e2w8hB1e2w8hB2e2w8hB3e2w8hC1e2w8hC2e2w8hC3e2w8hD1e2w8hD2e2w8hD3e2w8hE1e2w8hE2e2w8hE3e2w8hF1e2w8hF2e2w8hF3e2w8hG1e2w8hG2e2w8hG3e2w8hH1e2w8hH2e2w8hH3
ECOD domains from experimental PDB structures interacting with ligand DB08217
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hA1 | A:61-80,A:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hA2 | A:17-60,A:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hB1 | B:61-80,B:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hB2 | B:17-60,B:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hC1 | C:61-80,C:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hC2 | C:17-60,C:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hD1 | D:61-80,D:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hD2 | D:17-60,D:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hE1 | E:61-80,E:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hE2 | E:17-60,E:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hF1 | F:61-80,F:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hF2 | F:17-60,F:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hG1 | G:61-80,G:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hG2 | G:17-60,G:245-337 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hH1 | H:61-80,H:161-244 |
| Q9X4B7 | DB08217 | MTN | 2w8h | e2w8hH2 | H:17-60,H:245-337 |