Attributes
UniProt ID
Protein Name
6,7-dimethyl-8-ribityllumazine synthase, chloroplastic
Ligand Name
5-NITROSO-6-RIBITYL-AMINO-2,4(1H,3H)-PYRIMIDINEDIONE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
YMWIHKCBRFEJMH-RPDRRWSUSA-N
SMILES
C(C(C(C(CO)O)O)O)NC1=C(C(=O)NC(=O)N1)N=O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1C2Y
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1c2yA1e1c2yB1e1c2yC1e1c2yD1e1c2yE1e1c2yF1e1c2yG1e1c2yH1e1c2yI1e1c2yJ1e1c2yK1e1c2yL1e1c2yM1e1c2yN1e1c2yO1e1c2yP1e1c2yQ1e1c2yR1e1c2yS1e1c2yT1
ECOD domains from experimental PDB structures interacting with ligand DB04128
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yA1 | A:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yB1 | B:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yC1 | C:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yD1 | D:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yE1 | E:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yF1 | F:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yG1 | G:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yH1 | H:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yI1 | I:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yJ1 | J:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yK1 | K:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yL1 | L:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yM1 | M:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yN1 | N:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yO1 | O:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yP1 | P:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yQ1 | Q:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yR1 | R:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yS1 | S:1-155 |
| Q9XH32 | DB04128 | LMZ | 1c2y | e1c2yT1 | T:1-155 |