Attributes
UniProt ID
Protein Name
Deoxynucleoside kinase
Ligand Name
THYMIDINE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IQFYYKKMVGJFEH-XLPZGREQSA-N
SMILES
CC1=CN(C(=O)NC1=O)C2CC(C(O2)CO)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1OT3
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1ot3A1e1ot3B1e1ot3C1e1ot3D1e1ot3E1e1ot3F1e1ot3G1e1ot3H1
ECOD domains from experimental PDB structures interacting with ligand DB04485
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3A1 | A:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3B1 | B:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3C1 | C:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3D1 | D:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3E1 | E:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3F1 | F:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3G1 | G:12-208 |
| Q9XZT6 | DB04485 | THM | 1ot3 | e1ot3H1 | H:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxA1 | A:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxB1 | B:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxC1 | C:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxD1 | D:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxE1 | E:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxF1 | F:12-208 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxG1 | G:12-207 |
| Q9XZT6 | DB04485 | THM | 1zmx | e1zmxH1 | H:12-207 |