Attributes
UniProt ID
Protein Name
Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Ligand Name
2'-deoxyguanosine-5'-O-(1-thiotriphosphate)
DrugBank ID
None
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
IOCRYHATDKHWPM-KUFCIHQDSA-N
SMILES
c1nc2c(n1C3CC(C(O3)COP(=O)(OP(=O)(O)OP(=O)(O)O)S)O)NC(=NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 4BZC
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse4bzcA1e4bzcB1e4bzcC1e4bzcD1
ECOD domains from experimental PDB structures interacting with ligand T8T
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9Y3Z3 | n/a | T8T | 4bzc | e4bzcA1 | A:114-599 |
| Q9Y3Z3 | n/a | T8T | 4bzc | e4bzcB1 | B:113-599 |
| Q9Y3Z3 | n/a | T8T | 4bzc | e4bzcC1 | C:113-599 |
| Q9Y3Z3 | n/a | T8T | 4bzc | e4bzcD1 | D:113-599 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yA1 | A:113-581 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yB1 | B:114-582 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yC1 | C:113-582 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yD1 | D:114-579 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yE1 | E:114-582 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yF1 | F:113-581 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yG1 | G:113-588 |
| Q9Y3Z3 | n/a | T8T | 7a5y | e7a5yH1 | H:114-581 |
| Q9Y3Z3 | n/a | T8T | 7ujn | e7ujnA1 | A:113-599 |
| Q9Y3Z3 | n/a | T8T | 7ujn | e7ujnB1 | B:113-599 |
| Q9Y3Z3 | n/a | T8T | 7ujn | e7ujnC1 | C:113-599 |
| Q9Y3Z3 | n/a | T8T | 7ujn | e7ujnD1 | D:113-599 |