Attributes
UniProt ID
Protein Name
Mannose-1-phosphate guanylyltransferase catalytic subunit beta
Ligand Name
GUANOSINE-5'-TRIPHOSPHATE
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
XKMLYUALXHKNFT-UUOKFMHZSA-N
SMILES
c1nc2c(n1C3C(C(C(O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)N=C(NC2=O)N
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 7D73
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse7d73A1e7d73A2e7d73B1e7d73B2e7d73C1e7d73C2e7d73D1e7d73D2e7d73E1e7d73E2e7d73F1e7d73F2e7d73G1e7d73G2e7d73H1e7d73H2e7d73I1e7d73I2e7d73J1e7d73J2e7d73K1e7d73K2e7d73L1e7d73L2
ECOD domains from experimental PDB structures interacting with ligand DB04137
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73E1 | E:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73F1 | F:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73G2 | G:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73H1 | H:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73I1 | I:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73J2 | J:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73K1 | K:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d73 | e7d73L1 | L:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74E2 | E:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74F2 | F:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74G1 | G:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74H2 | H:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74I1 | I:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74J1 | J:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74K1 | K:1-230 |
| Q9Y5P6 | DB04137 | GTP | 7d74 | e7d74L1 | L:1-230 |