Attributes
UniProt ID
Protein Name
Cystathionine gamma-synthase
Ligand Name
2-[(3-HYDROXY-2-METHYL-5-PHOSPHONOOXYMETHYL-PYRIDIN-4-YLMETHYL)-IMINO]-5-PHOSPHONO-PENT-3-ENOIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
VKWJKURKEYQKKW-ZCOJICPHSA-N
SMILES
Cc1c(c(c(cn1)COP(=O)(O)O)CN=C(C=CCP(=O)(O)O)C(=O)O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1I41
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1i41A2e1i41A3e1i41B2e1i41B3e1i41C2e1i41C3e1i41D2e1i41D3e1i41E2e1i41E3e1i41F2e1i41F3e1i41G2e1i41G3e1i41H2e1i41H3e1i41I2e1i41I3e1i41J2e1i41J3e1i41K2e1i41K3e1i41L2e1i41L3
ECOD domains from experimental PDB structures interacting with ligand DB02328
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41A2 | A:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41A3 | A:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41B2 | B:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41B3 | B:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41C2 | C:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41C3 | C:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41D2 | D:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41D3 | D:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41E2 | E:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41E3 | E:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41F2 | F:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41F3 | F:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41G2 | G:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41G3 | G:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41H2 | H:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41H3 | H:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41I2 | I:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41I3 | I:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41J2 | J:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41J3 | J:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41K2 | K:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41K3 | K:50-310 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41L2 | L:311-445 |
| Q9ZPL5 | DB02328 | HEN | 1i41 | e1i41L3 | L:50-310 |