Attributes
UniProt ID
Protein Name
Cystathionine gamma-synthase
Ligand Name
3-(PHOSPHONOMETHYL)PYRIDINE-2-CARBOXYLIC ACID
DrugBank ID
PDB Ligand Accession
ChEMBL ID
n/a
PubChem ID
n/a
InChIKey
ROSWJUKEABEPFJ-UHFFFAOYSA-N
SMILES
c1cc(c(nc1)C(=O)O)CP(=O)(O)O
Drug Action
No data available
Affinity Metrics
No affinity data available
3D Structure
Interactive Mol* view for the current protein-molecule pair.
Structure: 1I43
Hover over the Mol* viewer to rotate or zoom with the mouse. Move the cursor out of the viewer to go back to normal page scrolling and one-click navigation.
Hover inside the viewer to rotate or zoom. Move out to scroll the page or click links normally.
Color Legend
Unassigned regionsLigand / hetero atomse1i43A2e1i43A3e1i43B2e1i43B3e1i43C2e1i43C3e1i43D2e1i43D3e1i43E2e1i43E3e1i43F2e1i43F3e1i43G2e1i43G3e1i43H2e1i43H3e1i43I2e1i43I3e1i43J2e1i43J3e1i43K2e1i43K3e1i43L2e1i43L3
ECOD domains from experimental PDB structures interacting with ligand DB04406
| UniProt | DrugBank | PDB Ligand | PDB ID | ECOD Domain | Range Definition |
|---|---|---|---|---|---|
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43A2 | A:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43A3 | A:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43B2 | B:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43B3 | B:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43C2 | C:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43C3 | C:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43D2 | D:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43D3 | D:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43E2 | E:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43E3 | E:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43F2 | F:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43F3 | F:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43G2 | G:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43G3 | G:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43H2 | H:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43H3 | H:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43I2 | I:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43I3 | I:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43J2 | J:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43J3 | J:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43K2 | K:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43K3 | K:50-310 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43L2 | L:311-445 |
| Q9ZPL5 | DB04406 | PMC | 1i43 | e1i43L3 | L:50-310 |